C29H41NO7 — CID 172640747
(2S,9S,13E)-2-cyclohexyl-22,25-dimethoxy-11,16,20-trioxa-4-azatricyclo[19.2.2.04,9]pentacosa-1(23),13,21,24-tetraene-3,10-dione (PubChem CID 172640747) has the molecular formula C29H41NO7 and a molecular weight of 515.65 g/mol. Its IUPAC name is (2S,9S,13E)-2-cyclohexyl-22,25-dimethoxy-11,16,20-trioxa-4-azatricyclo[19.2.2.04,9]pentacosa-1(23),13,21,24-tetraene-3,10-dione.
| Compound Name | (2S,9S,13E)-2-cyclohexyl-22,25-dimethoxy-11,16,20-trioxa-4-azatricyclo[19.2.2.04,9]pentacosa-1(23),13,21,24-tetraene-3,10-dione |
|---|---|
| PubChem CID | 172640747 |
| Molecular Formula | C29H41NO7 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | (2S,9S,13E)-2-cyclohexyl-22,25-dimethoxy-11,16,20-trioxa-4-azatricyclo[19.2.2.04,9]pentacosa-1(23),13,21,24-tetraene-3,10-dione |
| SMILES | COc1cc2cc(OC)c1OCCCOC/C=C/COC(=O)[C@@H]1CCCCN1C(=O)[C@H]2C1CCCCC1 |
| InChI | InChI=1S/C29H41NO7/c1-33-24-19-22-20-25(34-2)27(24)36-18-10-16-35-15-8-9-17-37-29(32)23-13-6-7-14-30(23)28(31)26(22)21-11-4-3-5-12-21/h8-9,19-21,23,26H,3-7,10-18H2,1-2H3/b9-8+/t23-,26-/m0/s1 |
| InChIKey | FUTIXVBBDMLNAR-XMQNWNBQSA-N |
| XLogP | 4.65 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|