C28H39NO6 — CID 172640749
(2S,9S,14E)-2-cyclohexyl-20,23-dimethoxy-11,18-dioxa-4-azatricyclo[17.2.2.04,9]tricosa-1(21),14,19,22-tetraene-3,10-dione (PubChem CID 172640749) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is (2S,9S,14E)-2-cyclohexyl-20,23-dimethoxy-11,18-dioxa-4-azatricyclo[17.2.2.04,9]tricosa-1(21),14,19,22-tetraene-3,10-dione.
| Compound Name | (2S,9S,14E)-2-cyclohexyl-20,23-dimethoxy-11,18-dioxa-4-azatricyclo[17.2.2.04,9]tricosa-1(21),14,19,22-tetraene-3,10-dione |
|---|---|
| PubChem CID | 172640749 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (2S,9S,14E)-2-cyclohexyl-20,23-dimethoxy-11,18-dioxa-4-azatricyclo[17.2.2.04,9]tricosa-1(21),14,19,22-tetraene-3,10-dione |
| SMILES | COc1cc2cc(OC)c1OCC/C=C/CCOC(=O)[C@@H]1CCCCN1C(=O)[C@H]2C1CCCCC1 |
| InChI | InChI=1S/C28H39NO6/c1-32-23-18-21-19-24(33-2)26(23)34-16-10-3-4-11-17-35-28(31)22-14-8-9-15-29(22)27(30)25(21)20-12-6-5-7-13-20/h3-4,18-20,22,25H,5-17H2,1-2H3/b4-3+/t22-,25-/m0/s1 |
| InChIKey | APNQEGPDNHCTEN-FZMRSDKKSA-N |
| XLogP | 5.02 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|