C27H39NO6 — CID 172640750
(2S,9S)-2-cyclohexyl-19,22-dimethoxy-11,17-dioxa-4-azatricyclo[16.2.2.04,9]docosa-1(20),18,21-triene-3,10-dione (PubChem CID 172640750) has the molecular formula C27H39NO6 and a molecular weight of 473.61 g/mol. Its IUPAC name is (2S,9S)-2-cyclohexyl-19,22-dimethoxy-11,17-dioxa-4-azatricyclo[16.2.2.04,9]docosa-1(20),18,21-triene-3,10-dione.
| Compound Name | (2S,9S)-2-cyclohexyl-19,22-dimethoxy-11,17-dioxa-4-azatricyclo[16.2.2.04,9]docosa-1(20),18,21-triene-3,10-dione |
|---|---|
| PubChem CID | 172640750 |
| Molecular Formula | C27H39NO6 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (2S,9S)-2-cyclohexyl-19,22-dimethoxy-11,17-dioxa-4-azatricyclo[16.2.2.04,9]docosa-1(20),18,21-triene-3,10-dione |
| SMILES | COc1cc2cc(OC)c1OCCCCCOC(=O)[C@@H]1CCCCN1C(=O)[C@H]2C1CCCCC1 |
| InChI | InChI=1S/C27H39NO6/c1-31-22-17-20-18-23(32-2)25(22)33-15-9-4-10-16-34-27(30)21-13-7-8-14-28(21)26(29)24(20)19-11-5-3-6-12-19/h17-19,21,24H,3-16H2,1-2H3/t21-,24-/m0/s1 |
| InChIKey | MMBHTRMJIYZADY-URXFXBBRSA-N |
| XLogP | 4.85 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |