C31H45NO7 — CID 172640756
(2S,9S,12R,14E)-2-cyclohexyl-23,24-dimethoxy-12-methyl-11,17,21-trioxa-4-azatricyclo[20.3.1.04,9]hexacosa-1(26),14,22,24-tetraene-3,10-dione (PubChem CID 172640756) has the molecular formula C31H45NO7 and a molecular weight of 543.70 g/mol. Its IUPAC name is (2S,9S,12R,14E)-2-cyclohexyl-23,24-dimethoxy-12-methyl-11,17,21-trioxa-4-azatricyclo[20.3.1.04,9]hexacosa-1(26),14,22,24-tetraene-3,10-dione.
| Compound Name | (2S,9S,12R,14E)-2-cyclohexyl-23,24-dimethoxy-12-methyl-11,17,21-trioxa-4-azatricyclo[20.3.1.04,9]hexacosa-1(26),14,22,24-tetraene-3,10-dione |
|---|---|
| PubChem CID | 172640756 |
| Molecular Formula | C31H45NO7 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | (2S,9S,12R,14E)-2-cyclohexyl-23,24-dimethoxy-12-methyl-11,17,21-trioxa-4-azatricyclo[20.3.1.04,9]hexacosa-1(26),14,22,24-tetraene-3,10-dione |
| SMILES | COc1cc2cc(c1OC)OCCCOC/C=C/C[C@@H](C)OC(=O)[C@@H]1CCCCN1C(=O)[C@H]2C1CCCCC1 |
| InChI | InChI=1S/C31H45NO7/c1-22-12-8-10-17-37-18-11-19-38-27-21-24(20-26(35-2)29(27)36-3)28(23-13-5-4-6-14-23)30(33)32-16-9-7-15-25(32)31(34)39-22/h8,10,20-23,25,28H,4-7,9,11-19H2,1-3H3/b10-8+/t22-,25+,28+/m1/s1 |
| InChIKey | DJTFXBXJBYJSQO-YSNFPQGISA-N |
| XLogP | 5.43 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|