C34H23NO9 — CID 172641384
(2,5-dioxopyrrolidin-1-yl) acetate;2-(7-hydroxy-19-oxo-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl)benzoic acid (PubChem CID 172641384) has the molecular formula C34H23NO9 and a molecular weight of 589.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) acetate;2-(7-hydroxy-19-oxo-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl)benzoic acid.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) acetate;2-(7-hydroxy-19-oxo-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl)benzoic acid |
|---|---|
| PubChem CID | 172641384 |
| Molecular Formula | C34H23NO9 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) acetate;2-(7-hydroxy-19-oxo-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl)benzoic acid |
| SMILES | CC(=O)ON1C(=O)CCC1=O.O=C(O)c1ccccc1-c1c2ccc3cc(O)ccc3c2oc2c1ccc1cc(=O)ccc12 |
| InChI | InChI=1S/C28H16O5.C6H7NO4/c29-17-7-11-19-15(13-17)5-9-23-25(21-3-1-2-4-22(21)28(31)32)24-10-6-16-14-18(30)8-12-20(16)27(24)33-26(19)23;1-4(8)11-7-5(9)2-3-6(7)10/h1-14,29H,(H,31,32);2-3H2,1H3 |
| InChIKey | RBJMXAONIBCNTH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|