C38H42ClN2O3S+ — CID 172641391
2-[2-[2-chloro-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethylindole;4-methylbenzenesulfonic acid (PubChem CID 172641391) has the molecular formula C38H42ClN2O3S+ and a molecular weight of 642.29 g/mol. Its IUPAC name is 2-[2-[2-chloro-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethylindole;4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[2-chloro-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethylindole;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 172641391 |
| Molecular Formula | C38H42ClN2O3S+ |
| Molecular Weight | 642.29 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 2-[2-[2-chloro-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethylindole;4-methylbenzenesulfonic acid |
| SMILES | CN1C(=CC=C2CCC(C=CC3=[N+](C)c4ccccc4C3(C)C)=C2Cl)C(C)(C)c2ccccc21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C31H34ClN2.C7H8O3S/c1-30(2)23-11-7-9-13-25(23)33(5)27(30)19-17-21-15-16-22(29(21)32)18-20-28-31(3,4)24-12-8-10-14-26(24)34(28)6;1-6-2-4-7(5-3-6)11(8,9)10/h7-14,17-20H,15-16H2,1-6H3;2-5H,1H3,(H,8,9,10)/q+1; |
| InChIKey | QCVUQADFHDUPLD-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.29 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|