C14H16N4O2 — CID 172642107
(6R)-6-(methylamino)-9-nitroso-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 172642107) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (6R)-6-(methylamino)-9-nitroso-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | (6R)-6-(methylamino)-9-nitroso-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 172642107 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (6R)-6-(methylamino)-9-nitroso-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CN[C@@H]1CCc2c(c3cc(C(N)=O)ccc3n2N=O)C1 |
| InChI | InChI=1S/C14H16N4O2/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)19)2-4-12(10)18(13)17-20/h2,4,6,9,16H,3,5,7H2,1H3,(H2,15,19)/t9-/m1/s1 |
| InChIKey | AWXGBMSSAGWCLL-SECBINFHSA-N |
| XLogP | 1.35 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|