C16H27N3Na2O14P2 — CID 172642549
Thymidine-5'-diphosphate-D-viosamine disodium salt (PubChem CID 172642549) has the molecular formula C16H27N3Na2O14P2 and a molecular weight of 593.33 g/mol.
| Compound Name | Thymidine-5'-diphosphate-D-viosamine disodium salt |
|---|---|
| PubChem CID | 172642549 |
| Molecular Formula | C16H27N3Na2O14P2 |
| Molecular Weight | 593.33 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | — |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](C)[C@@H](N)[C@H](O)[C@H]3O)O2)c(=O)[nH]c1=O.[Na].[Na] |
| InChI | InChI=1S/C16H27N3O14P2.2Na/c1-6-4-19(16(24)18-14(6)23)10-3-8(20)9(31-10)5-29-34(25,26)33-35(27,28)32-15-13(22)12(21)11(17)7(2)30-15;;/h4,7-13,15,20-22H,3,5,17H2,1-2H3,(H,25,26)(H,27,28)(H,18,23,24);;/t7-,8+,9-,10-,11-,12+,13-,15-;;/m1../s1 |
| InChIKey | ZDDKTTRDTDJLEB-GGXPPOHZSA-N |
| XLogP | -3.22 |
| TPSA | 262.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.33 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|