C24H48N14O6 — CID 172643135
1,4,6,9,11,14,17,19,22,24,29,31,34,36-tetradecazabicyclo[12.12.12]octatriacontane-5,10,18,23,30,35-hexone (PubChem CID 172643135) has the molecular formula C24H48N14O6 and a molecular weight of 628.74 g/mol. Its IUPAC name is 1,4,6,9,11,14,17,19,22,24,29,31,34,36-tetradecazabicyclo[12.12.12]octatriacontane-5,10,18,23,30,35-hexone.
| Compound Name | 1,4,6,9,11,14,17,19,22,24,29,31,34,36-tetradecazabicyclo[12.12.12]octatriacontane-5,10,18,23,30,35-hexone |
|---|---|
| PubChem CID | 172643135 |
| Molecular Formula | C24H48N14O6 |
| Molecular Weight | 628.74 g/mol |
| Exact Mass | 628.39 |
| IUPAC Name | 1,4,6,9,11,14,17,19,22,24,29,31,34,36-tetradecazabicyclo[12.12.12]octatriacontane-5,10,18,23,30,35-hexone |
| SMILES | O=C1NCCNC(=O)NCCN2CCNC(=O)NCCNC(=O)NCCN(CCN1)CCNC(=O)NCCNC(=O)NCC2 |
| InChI | InChI=1S/C24H48N14O6/c39-19-25-1-2-26-20(40)32-8-14-38-17-11-35-23(43)29-5-3-27-21(41)33-9-15-37(13-7-31-19)16-10-34-22(42)28-4-6-30-24(44)36-12-18-38/h1-18H2,(H2,25,31,39)(H2,26,32,40)(H2,27,33,41)(H2,28,34,42)(H2,29,35,43)(H2,30,36,44) |
| InChIKey | ISAMLAVCFRPHQT-UHFFFAOYSA-N |
| XLogP | -4.59 |
| TPSA | 253.26 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.74 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 8 |