C40H42N7O7+ — CID 172643408
[9-[2-carboxy-5-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 172643408) has the molecular formula C40H42N7O7+ and a molecular weight of 732.82 g/mol. Its IUPAC name is [9-[2-carboxy-5-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-5-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 172643408 |
| Molecular Formula | C40H42N7O7+ |
| Molecular Weight | 732.82 g/mol |
| Exact Mass | 732.31 |
| IUPAC Name | [9-[2-carboxy-5-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCNC(=O)c1ccc(C(=O)O)c(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)c1 |
| InChI | InChI=1S/C40H41N7O7/c1-46(2)25-8-11-28-31(19-25)54-32-20-26(47(3)4)9-12-29(32)35(28)30-18-23(7-10-27(30)39(49)50)38(48)43-13-14-53-36-33(51-5)16-22(17-34(36)52-6)15-24-21-44-40(42)45-37(24)41/h7-12,16-21H,13-15H2,1-6H3,(H5-,41,42,43,44,45,48,49,50)/p+1 |
| InChIKey | JYRINKWAGFHPTL-UHFFFAOYSA-O |
| XLogP | 4.37 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|