About 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile
6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile (PubChem CID 172643561) has the molecular formula C15H12N4O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile.
Molecular Properties
| Compound Name | 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile |
| PubChem CID | 172643561 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile |
| SMILES | CC1CC(=O)NN=C1C1=CC2C=CC(=O)N=C2C(C#N)=C1 |
| InChI | InChI=1S/C15H12N4O2/c1-8-4-13(21)18-19-14(8)10-5-9-2-3-12(20)17-15(9)11(6-10)7-16/h2-3,5-6,8-9H,4H2,1H3,(H,18,21) |
| InChIKey | OKELQXAIZYZIBE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile?
The IUPAC name of 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile (CID 172643561) is 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile.
What is the SMILES notation for 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile?
The canonical SMILES for 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile is CC1CC(=O)NN=C1C1=CC2C=CC(=O)N=C2C(C#N)=C1.
What is the InChIKey of 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile?
The InChIKey is OKELQXAIZYZIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O2/c1-8-4-13(21)18-19-14(8)10-5-9-2-3-12(20)17-15(9)11(6-10)7-16/h2-3,5-6,8-9H,4H2,1H3,(H,18,21).
What are the key properties of 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile?
6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile has a molecular weight of 280.29 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-oxo-4aH-quinoline-8-carbonitrile is sourced from PubChem (CID 172643561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).