C42H63NO — CID 172643733
2,4-ditert-butyl-6-[5-(2,4,4-trimethylpentan-2-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)anilino]phenyl]phenol (PubChem CID 172643733) has the molecular formula C42H63NO and a molecular weight of 597.97 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[5-(2,4,4-trimethylpentan-2-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)anilino]phenyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[5-(2,4,4-trimethylpentan-2-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)anilino]phenyl]phenol |
|---|---|
| PubChem CID | 172643733 |
| Molecular Formula | C42H63NO |
| Molecular Weight | 597.97 g/mol |
| Exact Mass | 597.49 |
| IUPAC Name | 2,4-ditert-butyl-6-[5-(2,4,4-trimethylpentan-2-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)anilino]phenyl]phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(Nc2ccc(C(C)(C)CC(C)(C)C)cc2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc1 |
| InChI | InChI=1S/C42H63NO/c1-37(2,3)26-41(13,14)28-17-20-31(21-18-28)43-35-22-19-29(42(15,16)27-38(4,5)6)23-32(35)33-24-30(39(7,8)9)25-34(36(33)44)40(10,11)12/h17-25,43-44H,26-27H2,1-16H3 |
| InChIKey | HTFVVAMALMQEFW-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.97 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |