C27H43F3O4S — CID 172643832
[8-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-chromen-7-yl] trifluoromethanesulfonate (PubChem CID 172643832) has the molecular formula C27H43F3O4S and a molecular weight of 520.70 g/mol. Its IUPAC name is [8-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-chromen-7-yl] trifluoromethanesulfonate.
| Compound Name | [8-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-chromen-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172643832 |
| Molecular Formula | C27H43F3O4S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [8-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-chromen-7-yl] trifluoromethanesulfonate |
| SMILES | Cc1c(OS(=O)(=O)C(F)(F)F)ccc2c1OC(CCCC(C)CCCC(C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C27H43F3O4S/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-24-17-15-23-16-18-25(22(5)26(23)33-24)34-35(31,32)27(28,29)30/h16,18-21,24H,6-15,17H2,1-5H3 |
| InChIKey | VPMFJSGOGVJAPP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|