C31H58O17P2 — CID 172643873
[(2R)-1-[[(2S)-3-[[(2R)-3-butanoyloxy-2-pentanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-pentanoyloxypropan-2-yl] octanoate (PubChem CID 172643873) has the molecular formula C31H58O17P2 and a molecular weight of 764.74 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-3-[[(2R)-3-butanoyloxy-2-pentanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-pentanoyloxypropan-2-yl] octanoate.
| Compound Name | [(2R)-1-[[(2S)-3-[[(2R)-3-butanoyloxy-2-pentanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-pentanoyloxypropan-2-yl] octanoate |
|---|---|
| PubChem CID | 172643873 |
| Molecular Formula | C31H58O17P2 |
| Molecular Weight | 764.74 g/mol |
| Exact Mass | 764.31 |
| IUPAC Name | [(2R)-1-[[(2S)-3-[[(2R)-3-butanoyloxy-2-pentanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-pentanoyloxypropan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H](COC(=O)CCCC)COP(=O)(O)OC[C@@H](O)COP(=O)(O)OC[C@@H](COC(=O)CCC)OC(=O)CCCC |
| InChI | InChI=1S/C31H58O17P2/c1-5-9-12-13-14-18-31(36)48-27(22-42-29(34)16-10-6-2)24-46-50(39,40)44-20-25(32)19-43-49(37,38)45-23-26(21-41-28(33)15-8-4)47-30(35)17-11-7-3/h25-27,32H,5-24H2,1-4H3,(H,37,38)(H,39,40)/t25-,26+,27+/m0/s1 |
| InChIKey | FOQIPXTUMMWKKT-OYUWMTPXSA-N |
| XLogP | 5.07 |
| TPSA | 236.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|