C15H26BN3O2 — CID 172644243
1-cyclobutyl-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine (PubChem CID 172644243) has the molecular formula C15H26BN3O2 and a molecular weight of 291.20 g/mol. Its IUPAC name is 1-cyclobutyl-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine.
| Compound Name | 1-cyclobutyl-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 172644243 |
| Molecular Formula | C15H26BN3O2 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 1-cyclobutyl-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine |
| SMILES | CN(C)c1nc(B2OC(C)(C)C(C)(C)O2)cn1C1CCC1 |
| InChI | InChI=1S/C15H26BN3O2/c1-14(2)15(3,4)21-16(20-14)12-10-19(11-8-7-9-11)13(17-12)18(5)6/h10-11H,7-9H2,1-6H3 |
| InChIKey | XTNVWWDWCZWINM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|