C13H19BN2O4 — CID 172644636
2-(oxetan-3-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine (PubChem CID 172644636) has the molecular formula C13H19BN2O4 and a molecular weight of 278.12 g/mol. Its IUPAC name is 2-(oxetan-3-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine.
| Compound Name | 2-(oxetan-3-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
|---|---|
| PubChem CID | 172644636 |
| Molecular Formula | C13H19BN2O4 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(oxetan-3-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
| SMILES | CC1(C)OB(c2cnc(OC3COC3)cn2)OC1(C)C |
| InChI | InChI=1S/C13H19BN2O4/c1-12(2)13(3,4)20-14(19-12)10-5-16-11(6-15-10)18-9-7-17-8-9/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | DPLWIVZPLUEAGB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|