C16H26BNO2 — CID 172645071
2-butan-2-yl-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 172645071) has the molecular formula C16H26BNO2 and a molecular weight of 275.20 g/mol. Its IUPAC name is 2-butan-2-yl-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-butan-2-yl-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 172645071 |
| Molecular Formula | C16H26BNO2 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-butan-2-yl-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CCC(C)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C)n1 |
| InChI | InChI=1S/C16H26BNO2/c1-8-11(2)14-10-13(9-12(3)18-14)17-19-15(4,5)16(6,7)20-17/h9-11H,8H2,1-7H3 |
| InChIKey | HUNCVRYPYXZAGA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|