C11H20BN3O2 — CID 172645242
2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole (PubChem CID 172645242) has the molecular formula C11H20BN3O2 and a molecular weight of 237.11 g/mol. Its IUPAC name is 2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole.
| Compound Name | 2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
|---|---|
| PubChem CID | 172645242 |
| Molecular Formula | C11H20BN3O2 |
| Molecular Weight | 237.11 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
| SMILES | CCCn1ncc(B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C11H20BN3O2/c1-6-7-15-13-8-9(14-15)12-16-10(2,3)11(4,5)17-12/h8H,6-7H2,1-5H3 |
| InChIKey | NVOKDTFSDLNOFV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.11 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|