C22H31BF3NO4 — CID 172645345
tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate (PubChem CID 172645345) has the molecular formula C22H31BF3NO4 and a molecular weight of 441.30 g/mol. Its IUPAC name is tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172645345 |
| Molecular Formula | C22H31BF3NO4 |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H31BF3NO4/c1-19(2,3)29-18(28)27-11-10-14(13-27)16-9-8-15(12-17(16)22(24,25)26)23-30-20(4,5)21(6,7)31-23/h8-9,12,14H,10-11,13H2,1-7H3 |
| InChIKey | WHJOSTGYHCRYPM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|