C9H16O4 — CID 172645646
[(1R,4S,5S)-5-(hydroxymethyl)-4-(methoxymethoxy)cyclopent-2-en-1-yl]methanol (PubChem CID 172645646) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is [(1R,4S,5S)-5-(hydroxymethyl)-4-(methoxymethoxy)cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S,5S)-5-(hydroxymethyl)-4-(methoxymethoxy)cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 172645646 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(1R,4S,5S)-5-(hydroxymethyl)-4-(methoxymethoxy)cyclopent-2-en-1-yl]methanol |
| SMILES | COCO[C@H]1C=C[C@@H](CO)[C@H]1CO |
| InChI | InChI=1S/C9H16O4/c1-12-6-13-9-3-2-7(4-10)8(9)5-11/h2-3,7-11H,4-6H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | SOUSDANGKAIQRG-YIZRAAEISA-N |
| XLogP | -0.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|