C17H32O5Si — CID 172645734
[(1R,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)cyclopent-3-en-1-yl]methyl acetate (PubChem CID 172645734) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is [(1R,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)cyclopent-3-en-1-yl]methyl acetate.
| Compound Name | [(1R,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)cyclopent-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 172645734 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(1R,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethoxy)cyclopent-3-en-1-yl]methyl acetate |
| SMILES | COCO[C@@H]1C=C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)=O |
| InChI | InChI=1S/C17H32O5Si/c1-13(18)20-11-15-14(8-9-16(15)21-12-19-5)10-22-23(6,7)17(2,3)4/h8-9,14-16H,10-12H2,1-7H3/t14-,15+,16-/m1/s1 |
| InChIKey | LPQKOZNJIGACIM-OWCLPIDISA-N |
| XLogP | 3.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|