C13H14BrF2NO — CID 172646662
4-bromo-N-cyclohexyl-3,5-difluorobenzamide (PubChem CID 172646662) has the molecular formula C13H14BrF2NO and a molecular weight of 318.16 g/mol. Its IUPAC name is 4-bromo-N-cyclohexyl-3,5-difluorobenzamide.
| Compound Name | 4-bromo-N-cyclohexyl-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 172646662 |
| Molecular Formula | C13H14BrF2NO |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-bromo-N-cyclohexyl-3,5-difluorobenzamide |
| SMILES | O=C(NC1CCCCC1)c1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C13H14BrF2NO/c14-12-10(15)6-8(7-11(12)16)13(18)17-9-4-2-1-3-5-9/h6-7,9H,1-5H2,(H,17,18) |
| InChIKey | UTCDJCAUVONGLA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|