C14H11F2NO3S — CID 172648780
3,5-difluoro-4-(3-methylsulfonylphenyl)benzamide (PubChem CID 172648780) has the molecular formula C14H11F2NO3S and a molecular weight of 311.31 g/mol. Its IUPAC name is 3,5-difluoro-4-(3-methylsulfonylphenyl)benzamide.
| Compound Name | 3,5-difluoro-4-(3-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 172648780 |
| Molecular Formula | C14H11F2NO3S |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 3,5-difluoro-4-(3-methylsulfonylphenyl)benzamide |
| SMILES | CS(=O)(=O)c1cccc(-c2c(F)cc(C(N)=O)cc2F)c1 |
| InChI | InChI=1S/C14H11F2NO3S/c1-21(19,20)10-4-2-3-8(5-10)13-11(15)6-9(14(17)18)7-12(13)16/h2-7H,1H3,(H2,17,18) |
| InChIKey | WLXINTPINFCYIA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |