C15H11F6NO — CID 172649997
[2-(trifluoromethoxy)-5-[4-(trifluoromethyl)phenyl]phenyl]methanamine (PubChem CID 172649997) has the molecular formula C15H11F6NO and a molecular weight of 335.25 g/mol. Its IUPAC name is [2-(trifluoromethoxy)-5-[4-(trifluoromethyl)phenyl]phenyl]methanamine.
| Compound Name | [2-(trifluoromethoxy)-5-[4-(trifluoromethyl)phenyl]phenyl]methanamine |
|---|---|
| PubChem CID | 172649997 |
| Molecular Formula | C15H11F6NO |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | [2-(trifluoromethoxy)-5-[4-(trifluoromethyl)phenyl]phenyl]methanamine |
| SMILES | NCc1cc(-c2ccc(C(F)(F)F)cc2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C15H11F6NO/c16-14(17,18)12-4-1-9(2-5-12)10-3-6-13(11(7-10)8-22)23-15(19,20)21/h1-7H,8,22H2 |
| InChIKey | KMRYMQRIWJUSLS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |