About 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone
1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone (PubChem CID 172651092) has the molecular formula C15H13F2NO2
and a molecular weight of 277.27 g/mol. Its IUPAC name is 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone |
| PubChem CID | 172651092 |
| Molecular Formula | C15H13F2NO2 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCC(F)F)c(-c2cccnc2)c1 |
| InChI | InChI=1S/C15H13F2NO2/c1-10(19)11-4-5-14(20-9-15(16)17)13(7-11)12-3-2-6-18-8-12/h2-8,15H,9H2,1H3 |
| InChIKey | PBXXXHKIALNFFC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone?
The IUPAC name of 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone (CID 172651092) is 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone.
What is the SMILES notation for 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone?
The canonical SMILES for 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone is CC(=O)c1ccc(OCC(F)F)c(-c2cccnc2)c1.
What is the InChIKey of 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone?
The InChIKey is PBXXXHKIALNFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO2/c1-10(19)11-4-5-14(20-9-15(16)17)13(7-11)12-3-2-6-18-8-12/h2-8,15H,9H2,1H3.
What are the key properties of 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone?
1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone has a molecular weight of 277.27 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2-difluoroethoxy)-3-pyridin-3-ylphenyl]ethanone is sourced from PubChem (CID 172651092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).