C16H20N2O2 — CID 172651292
5-propoxy-2-(1,3,5-trimethylpyrazol-4-yl)benzaldehyde (PubChem CID 172651292) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-propoxy-2-(1,3,5-trimethylpyrazol-4-yl)benzaldehyde.
| Compound Name | 5-propoxy-2-(1,3,5-trimethylpyrazol-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 172651292 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-propoxy-2-(1,3,5-trimethylpyrazol-4-yl)benzaldehyde |
| SMILES | CCCOc1ccc(-c2c(C)nn(C)c2C)c(C=O)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-5-8-20-14-6-7-15(13(9-14)10-19)16-11(2)17-18(4)12(16)3/h6-7,9-10H,5,8H2,1-4H3 |
| InChIKey | MZUCXPLQYROWSR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|