C15H13F3O2 — CID 172651631
[2-ethoxy-4-(2,4,5-trifluorophenyl)phenyl]methanol (PubChem CID 172651631) has the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. Its IUPAC name is [2-ethoxy-4-(2,4,5-trifluorophenyl)phenyl]methanol.
| Compound Name | [2-ethoxy-4-(2,4,5-trifluorophenyl)phenyl]methanol |
|---|---|
| PubChem CID | 172651631 |
| Molecular Formula | C15H13F3O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | [2-ethoxy-4-(2,4,5-trifluorophenyl)phenyl]methanol |
| SMILES | CCOc1cc(-c2cc(F)c(F)cc2F)ccc1CO |
| InChI | InChI=1S/C15H13F3O2/c1-2-20-15-5-9(3-4-10(15)8-19)11-6-13(17)14(18)7-12(11)16/h3-7,19H,2,8H2,1H3 |
| InChIKey | DAVZWQHNPVLGEC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|