C28H48O9 — CID 172651732
(3R,4R,5S)-3,4-dihydroxy-5-[(1R,2R,3S,4S,5R,6R,10E,15E,17E)-1,2,3,4,5-pentahydroxy-6,20,20-trimethylhenicosa-10,15,17-trienyl]oxolan-2-one (PubChem CID 172651732) has the molecular formula C28H48O9 and a molecular weight of 528.68 g/mol. Its IUPAC name is (3R,4R,5S)-3,4-dihydroxy-5-[(1R,2R,3S,4S,5R,6R,10E,15E,17E)-1,2,3,4,5-pentahydroxy-6,20,20-trimethylhenicosa-10,15,17-trienyl]oxolan-2-one.
| Compound Name | (3R,4R,5S)-3,4-dihydroxy-5-[(1R,2R,3S,4S,5R,6R,10E,15E,17E)-1,2,3,4,5-pentahydroxy-6,20,20-trimethylhenicosa-10,15,17-trienyl]oxolan-2-one |
|---|---|
| PubChem CID | 172651732 |
| Molecular Formula | C28H48O9 |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | (3R,4R,5S)-3,4-dihydroxy-5-[(1R,2R,3S,4S,5R,6R,10E,15E,17E)-1,2,3,4,5-pentahydroxy-6,20,20-trimethylhenicosa-10,15,17-trienyl]oxolan-2-one |
| SMILES | C[C@H](CCC/C=C/CCC/C=C/C=C/CC(C)(C)C)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1OC(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H48O9/c1-18(16-14-12-10-8-6-5-7-9-11-13-15-17-28(2,3)4)19(29)20(30)21(31)22(32)23(33)26-24(34)25(35)27(36)37-26/h8-11,13,15,18-26,29-35H,5-7,12,14,16-17H2,1-4H3/b10-8+,11-9+,15-13+/t18-,19-,20+,21+,22-,23-,24-,25-,26+/m1/s1 |
| InChIKey | UKQORWIBGSCKNH-AWFXPJMBSA-N |
| XLogP | 1.52 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|