C11H18O8 — CID 172651788
1,5-dihydroxy-3-methylidene-1-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]pentan-2-one (PubChem CID 172651788) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1,5-dihydroxy-3-methylidene-1-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]pentan-2-one.
| Compound Name | 1,5-dihydroxy-3-methylidene-1-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]pentan-2-one |
|---|---|
| PubChem CID | 172651788 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1,5-dihydroxy-3-methylidene-1-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]pentan-2-one |
| SMILES | C=C(CCO)C(=O)C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H18O8/c1-4(2-3-12)5(13)7(15)10-8(16)6(14)9(17)11(18)19-10/h6-12,14-18H,1-3H2/t6-,7?,8-,9+,10+,11?/m0/s1 |
| InChIKey | ZPVYNAAGVFLWJU-GKZJNTHNSA-N |
| XLogP | -3.35 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|