C27H43NO4 — CID 172651895
(7Z,10Z,13Z,16Z,19Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxodocosa-7,10,13,16,19-pentaenoate (PubChem CID 172651895) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z,19Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxodocosa-7,10,13,16,19-pentaenoate.
| Compound Name | (7Z,10Z,13Z,16Z,19Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxodocosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 172651895 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (7Z,10Z,13Z,16Z,19Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxodocosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)C(C(=O)[O-])C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C27H43NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(29)26(27(31)32)25(30)23-28(2,3)4/h6-7,9-10,12-13,15-16,18-19,25-26,30H,5,8,11,14,17,20-23H2,1-4H3/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | JTRFKPVMCGAUDZ-WMPRHZDHSA-N |
| XLogP | 3.91 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|