About zinc;benzene;ethene
zinc;benzene;ethene (PubChem CID 172652007) has the molecular formula C8H8Zn
and a molecular weight of 169.54 g/mol. Its IUPAC name is zinc;benzene;ethene.
Molecular Properties
| Compound Name | zinc;benzene;ethene |
| PubChem CID | 172652007 |
| Molecular Formula | C8H8Zn |
| Molecular Weight | 169.54 g/mol |
| Exact Mass | 167.99 |
| IUPAC Name | zinc;benzene;ethene |
| SMILES | [H][C-]=C.[Zn+2].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.C2H3.Zn/c1-2-4-6-5-3-1;1-2;/h1-5H;1H,2H2;/q2*-1;+2 |
| InChIKey | ICRDWBWXIBRIRW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;benzene;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;benzene;ethene?
The IUPAC name of zinc;benzene;ethene (CID 172652007) is zinc;benzene;ethene.
What is the SMILES notation for zinc;benzene;ethene?
The canonical SMILES for zinc;benzene;ethene is [H][C-]=C.[Zn+2].[c-]1ccccc1.
What is the InChIKey of zinc;benzene;ethene?
The InChIKey is ICRDWBWXIBRIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.C2H3.Zn/c1-2-4-6-5-3-1;1-2;/h1-5H;1H,2H2;/q2*-1;+2.
What are the key properties of zinc;benzene;ethene?
zinc;benzene;ethene has a molecular weight of 169.54 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;benzene;ethene is sourced from PubChem (CID 172652007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).