C18H17F3O2 — CID 172652338
5-[4-(2-methylpropyl)phenyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 172652338) has the molecular formula C18H17F3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 5-[4-(2-methylpropyl)phenyl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-[4-(2-methylpropyl)phenyl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 172652338 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 5-[4-(2-methylpropyl)phenyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)Cc1ccc(-c2ccc(C(F)(F)F)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H17F3O2/c1-11(2)9-12-3-5-13(6-4-12)14-7-8-16(18(19,20)21)15(10-14)17(22)23/h3-8,10-11H,9H2,1-2H3,(H,22,23) |
| InChIKey | BODPHMRTAPXWRG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |