C24H29N5O — CID 172653232
N-(2-aminophenyl)-2,3,5,6-tetradeuterio-4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]benzamide (PubChem CID 172653232) has the molecular formula C24H29N5O and a molecular weight of 407.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-2,3,5,6-tetradeuterio-4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]benzamide.
| Compound Name | N-(2-aminophenyl)-2,3,5,6-tetradeuterio-4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 172653232 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-(2-aminophenyl)-2,3,5,6-tetradeuterio-4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]benzamide |
| SMILES | [2H]c1c([2H])c(C2CCN(Cc3cn(C)nc3C)CC2)c([2H])c([2H])c1C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C24H29N5O/c1-17-21(15-28(2)27-17)16-29-13-11-19(12-14-29)18-7-9-20(10-8-18)24(30)26-23-6-4-3-5-22(23)25/h3-10,15,19H,11-14,16,25H2,1-2H3,(H,26,30)/i7D,8D,9D,10D |
| InChIKey | JHDZMASHNBKTPS-ULDPCNCHSA-N |
| XLogP | 3.94 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|