C14H25NO3 — CID 172653385
(2E,6R,7E,9R)-6,9-dihydroxy-N-(2-methylpropyl)deca-2,7-dienamide (PubChem CID 172653385) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (2E,6R,7E,9R)-6,9-dihydroxy-N-(2-methylpropyl)deca-2,7-dienamide.
| Compound Name | (2E,6R,7E,9R)-6,9-dihydroxy-N-(2-methylpropyl)deca-2,7-dienamide |
|---|---|
| PubChem CID | 172653385 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (2E,6R,7E,9R)-6,9-dihydroxy-N-(2-methylpropyl)deca-2,7-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/CC[C@@H](O)/C=C/[C@@H](C)O |
| InChI | InChI=1S/C14H25NO3/c1-11(2)10-15-14(18)7-5-4-6-13(17)9-8-12(3)16/h5,7-9,11-13,16-17H,4,6,10H2,1-3H3,(H,15,18)/b7-5+,9-8+/t12-,13-/m1/s1 |
| InChIKey | FEUMKDRLSICPNR-MWBBVWBASA-N |
| XLogP | 1.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|