C21H41O10P — CID 172653962
[(2S)-1-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate (PubChem CID 172653962) has the molecular formula C21H41O10P and a molecular weight of 484.52 g/mol. Its IUPAC name is [(2S)-1-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate.
| Compound Name | [(2S)-1-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate |
|---|---|
| PubChem CID | 172653962 |
| Molecular Formula | C21H41O10P |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | [(2S)-1-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H](COC(=O)CCCCCC)COP(=O)(O)OC[C@H](O)CO |
| InChI | InChI=1S/C21H41O10P/c1-3-5-7-9-11-13-21(25)31-19(16-28-20(24)12-10-8-6-4-2)17-30-32(26,27)29-15-18(23)14-22/h18-19,22-23H,3-17H2,1-2H3,(H,26,27)/t18-,19+/m1/s1 |
| InChIKey | VOCBXBUKJVZZKO-MOPGFXCFSA-N |
| XLogP | 3.26 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|