About (Z)-5-methyldec-5-ene-2,4,7,9-tetrone
(Z)-5-methyldec-5-ene-2,4,7,9-tetrone (PubChem CID 172655041) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (Z)-5-methyldec-5-ene-2,4,7,9-tetrone.
Molecular Properties
| Compound Name | (Z)-5-methyldec-5-ene-2,4,7,9-tetrone |
| PubChem CID | 172655041 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (Z)-5-methyldec-5-ene-2,4,7,9-tetrone |
| SMILES | CC(=O)CC(=O)/C=C(/C)C(=O)CC(C)=O |
| InChI | InChI=1S/C11H14O4/c1-7(11(15)6-9(3)13)4-10(14)5-8(2)12/h4H,5-6H2,1-3H3/b7-4- |
| InChIKey | SPMDXQZJOQABOW-DAXSKMNVSA-N |
| XLogP | 1.03 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-methyldec-5-ene-2,4,7,9-tetrone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-methyldec-5-ene-2,4,7,9-tetrone?
The IUPAC name of (Z)-5-methyldec-5-ene-2,4,7,9-tetrone (CID 172655041) is (Z)-5-methyldec-5-ene-2,4,7,9-tetrone.
What is the SMILES notation for (Z)-5-methyldec-5-ene-2,4,7,9-tetrone?
The canonical SMILES for (Z)-5-methyldec-5-ene-2,4,7,9-tetrone is CC(=O)CC(=O)/C=C(/C)C(=O)CC(C)=O.
What is the InChIKey of (Z)-5-methyldec-5-ene-2,4,7,9-tetrone?
The InChIKey is SPMDXQZJOQABOW-DAXSKMNVSA-N. The full InChI is InChI=1S/C11H14O4/c1-7(11(15)6-9(3)13)4-10(14)5-8(2)12/h4H,5-6H2,1-3H3/b7-4-.
What are the key properties of (Z)-5-methyldec-5-ene-2,4,7,9-tetrone?
(Z)-5-methyldec-5-ene-2,4,7,9-tetrone has a molecular weight of 210.23 g/mol, XLogP of 1.03, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-methyldec-5-ene-2,4,7,9-tetrone is sourced from PubChem (CID 172655041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).