C25H21N3O — CID 172655114
2-[5-methyl-1-[(3-methylphenyl)methyl]benzimidazol-2-yl]quinolin-8-ol (PubChem CID 172655114) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[5-methyl-1-[(3-methylphenyl)methyl]benzimidazol-2-yl]quinolin-8-ol.
| Compound Name | 2-[5-methyl-1-[(3-methylphenyl)methyl]benzimidazol-2-yl]quinolin-8-ol |
|---|---|
| PubChem CID | 172655114 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-[5-methyl-1-[(3-methylphenyl)methyl]benzimidazol-2-yl]quinolin-8-ol |
| SMILES | Cc1cccc(Cn2c(-c3ccc4cccc(O)c4n3)nc3cc(C)ccc32)c1 |
| InChI | InChI=1S/C25H21N3O/c1-16-5-3-6-18(13-16)15-28-22-12-9-17(2)14-21(22)27-25(28)20-11-10-19-7-4-8-23(29)24(19)26-20/h3-14,29H,15H2,1-2H3 |
| InChIKey | FAKRLOKNNKYONC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |