C18H27N5O — CID 172655216
(3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172655216) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172655216 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CCc1nc(CN2C[C@H]3C[C@@H](n4cccn4)[C@H](O)C[C@H]3C2)c(C)[nH]1 |
| InChI | InChI=1S/C18H27N5O/c1-3-18-20-12(2)15(21-18)11-22-9-13-7-16(23-6-4-5-19-23)17(24)8-14(13)10-22/h4-6,13-14,16-17,24H,3,7-11H2,1-2H3,(H,20,21)/t13-,14+,16-,17-/m1/s1 |
| InChIKey | KQKHJPALCXGMAR-YALNPMBYSA-N |
| XLogP | 1.92 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |