C25H33N3O3 — CID 172655374
4-methyl-3-[3-(morpholin-4-ylmethyl)piperidine-1-carbonyl]-1-(2-phenylethyl)pyridin-2-one (PubChem CID 172655374) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-methyl-3-[3-(morpholin-4-ylmethyl)piperidine-1-carbonyl]-1-(2-phenylethyl)pyridin-2-one.
| Compound Name | 4-methyl-3-[3-(morpholin-4-ylmethyl)piperidine-1-carbonyl]-1-(2-phenylethyl)pyridin-2-one |
|---|---|
| PubChem CID | 172655374 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 4-methyl-3-[3-(morpholin-4-ylmethyl)piperidine-1-carbonyl]-1-(2-phenylethyl)pyridin-2-one |
| SMILES | Cc1ccn(CCc2ccccc2)c(=O)c1C(=O)N1CCCC(CN2CCOCC2)C1 |
| InChI | InChI=1S/C25H33N3O3/c1-20-9-12-27(13-10-21-6-3-2-4-7-21)24(29)23(20)25(30)28-11-5-8-22(19-28)18-26-14-16-31-17-15-26/h2-4,6-7,9,12,22H,5,8,10-11,13-19H2,1H3 |
| InChIKey | OLXQSZGZMGWYFB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |