C19H25FN4O2 — CID 172655466
(3aR,5R,6R,7aS)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172655466) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172655466 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CCn1cnnc1CN1C[C@H]2C[C@@H](Oc3ccc(F)cc3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C19H25FN4O2/c1-2-24-12-21-22-19(24)11-23-9-13-7-17(25)18(8-14(13)10-23)26-16-5-3-15(20)4-6-16/h3-6,12-14,17-18,25H,2,7-11H2,1H3/t13-,14+,17+,18+/m0/s1 |
| InChIKey | HOAXLMXOGBVGAH-MJSCVDMRSA-N |
| XLogP | 2.09 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |