C20H20ClFN2O4 — CID 172655637
6-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-chloropyridine-3-carboxylic acid (PubChem CID 172655637) has the molecular formula C20H20ClFN2O4 and a molecular weight of 406.84 g/mol. Its IUPAC name is 6-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-chloropyridine-3-carboxylic acid.
| Compound Name | 6-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-chloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 172655637 |
| Molecular Formula | C20H20ClFN2O4 |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 6-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-chloropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2C[C@H]3C[C@@H](Oc4ccc(F)cc4)[C@H](O)C[C@H]3C2)c(Cl)c1 |
| InChI | InChI=1S/C20H20ClFN2O4/c21-16-5-11(20(26)27)8-23-19(16)24-9-12-6-17(25)18(7-13(12)10-24)28-15-3-1-14(22)2-4-15/h1-5,8,12-13,17-18,25H,6-7,9-10H2,(H,26,27)/t12-,13+,17+,18+/m0/s1 |
| InChIKey | LZXZOGQNRJKYOP-QIZIZJAASA-N |
| XLogP | 3.23 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |