C20H30N4O4S — CID 172656079
(3aS,5R,6R,7aR)-2-[5-(4,5-dimethyl-1H-pyrazol-3-yl)furan-2-yl]sulfonyl-6-methoxy-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 172656079) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-2-[5-(4,5-dimethyl-1H-pyrazol-3-yl)furan-2-yl]sulfonyl-6-methoxy-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aS,5R,6R,7aR)-2-[5-(4,5-dimethyl-1H-pyrazol-3-yl)furan-2-yl]sulfonyl-6-methoxy-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 172656079 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (3aS,5R,6R,7aR)-2-[5-(4,5-dimethyl-1H-pyrazol-3-yl)furan-2-yl]sulfonyl-6-methoxy-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CO[C@@H]1C[C@H]2CN(S(=O)(=O)c3ccc(-c4n[nH]c(C)c4C)o3)C[C@H]2C[C@H]1N(C)C |
| InChI | InChI=1S/C20H30N4O4S/c1-12-13(2)21-22-20(12)17-6-7-19(28-17)29(25,26)24-10-14-8-16(23(3)4)18(27-5)9-15(14)11-24/h6-7,14-16,18H,8-11H2,1-5H3,(H,21,22)/t14-,15+,16-,18-/m1/s1 |
| InChIKey | JBYLBMQMIIPXQM-KYHPRHEASA-N |
| XLogP | 2.26 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |