C26H29FN4O4S2 — CID 17265609
methyl 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 17265609) has the molecular formula C26H29FN4O4S2 and a molecular weight of 544.67 g/mol. Its IUPAC name is methyl 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17265609 |
| Molecular Formula | C26H29FN4O4S2 |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | methyl 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC)CCCCC3)nnc1C(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C26H29FN4O4S2/c1-4-14-31-23(16(2)35-18-12-10-17(27)11-13-18)29-30-26(31)36-15-21(32)28-24-22(25(33)34-3)19-8-6-5-7-9-20(19)37-24/h4,10-13,16H,1,5-9,14-15H2,2-3H3,(H,28,32) |
| InChIKey | CDINEHRGJBWQNT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|