C21H28N4O3S — CID 172657420
N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172657420) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172657420 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(Cc3cc(=O)n4ccsc4n3)C[C@@H]2C[C@H]1OCC1CC1 |
| InChI | InChI=1S/C21H28N4O3S/c1-13(26)22-18-6-15-9-24(10-16(15)7-19(18)28-12-14-2-3-14)11-17-8-20(27)25-4-5-29-21(25)23-17/h4-5,8,14-16,18-19H,2-3,6-7,9-12H2,1H3,(H,22,26)/t15-,16+,18-,19-/m1/s1 |
| InChIKey | PHJKRQPCEIMAPO-UKBAYJJMSA-N |
| XLogP | 1.90 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |