C22H31N5O2 — CID 172657562
N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(2-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(dimethylamino)acetamide (PubChem CID 172657562) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(2-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(dimethylamino)acetamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(2-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 172657562 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(2-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)N[C@H]1C[C@H]2CN(Cc3ccccc3-n3cccn3)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C22H31N5O2/c1-25(2)15-22(29)24-19-10-17-13-26(14-18(17)11-21(19)28)12-16-6-3-4-7-20(16)27-9-5-8-23-27/h3-9,17-19,21,28H,10-15H2,1-2H3,(H,24,29)/t17-,18+,19-,21-/m0/s1 |
| InChIKey | TWYYHTZFCIAXGM-JTJHWIPRSA-N |
| XLogP | 1.12 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |