C22H27N3O5 — CID 172658248
methyl 3-[[(3aS,5R,6R,7aR)-6-hydroxy-2-[(2-methoxypyrimidin-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate (PubChem CID 172658248) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl 3-[[(3aS,5R,6R,7aR)-6-hydroxy-2-[(2-methoxypyrimidin-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate.
| Compound Name | methyl 3-[[(3aS,5R,6R,7aR)-6-hydroxy-2-[(2-methoxypyrimidin-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
|---|---|
| PubChem CID | 172658248 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 3-[[(3aS,5R,6R,7aR)-6-hydroxy-2-[(2-methoxypyrimidin-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
| SMILES | COC(=O)c1cccc(O[C@@H]2C[C@@H]3CN(Cc4cnc(OC)nc4)C[C@@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-28-21(27)15-4-3-5-18(6-15)30-20-8-17-13-25(12-16(17)7-19(20)26)11-14-9-23-22(29-2)24-10-14/h3-6,9-10,16-17,19-20,26H,7-8,11-13H2,1-2H3/t16-,17+,19+,20+/m0/s1 |
| InChIKey | IPTHNQMFDANHME-ONCXSQPRSA-N |
| XLogP | 1.92 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |