C25H25N5O2 — CID 172658261
6-(1H-indazol-5-yl)-N-[3-(3-oxopiperazin-1-yl)propyl]naphthalene-2-carboxamide (PubChem CID 172658261) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 6-(1H-indazol-5-yl)-N-[3-(3-oxopiperazin-1-yl)propyl]naphthalene-2-carboxamide.
| Compound Name | 6-(1H-indazol-5-yl)-N-[3-(3-oxopiperazin-1-yl)propyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 172658261 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 6-(1H-indazol-5-yl)-N-[3-(3-oxopiperazin-1-yl)propyl]naphthalene-2-carboxamide |
| SMILES | O=C1CN(CCCNC(=O)c2ccc3cc(-c4ccc5[nH]ncc5c4)ccc3c2)CCN1 |
| InChI | InChI=1S/C25H25N5O2/c31-24-16-30(11-9-26-24)10-1-8-27-25(32)21-5-4-18-12-17(2-3-19(18)13-21)20-6-7-23-22(14-20)15-28-29-23/h2-7,12-15H,1,8-11,16H2,(H,26,31)(H,27,32)(H,28,29) |
| InChIKey | XWFIBRSXTNAUBJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|