C22H31N5O2 — CID 172658488
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(benzimidazol-1-yl)ethanone (PubChem CID 172658488) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(benzimidazol-1-yl)ethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(benzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 172658488 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(benzimidazol-1-yl)ethanone |
| SMILES | CN1CCN([C@@H]2C[C@@H]3CN(C(=O)Cn4cnc5ccccc54)C[C@@H]3C[C@H]2O)CC1 |
| InChI | InChI=1S/C22H31N5O2/c1-24-6-8-25(9-7-24)20-10-16-12-26(13-17(16)11-21(20)28)22(29)14-27-15-23-18-4-2-3-5-19(18)27/h2-5,15-17,20-21,28H,6-14H2,1H3/t16-,17+,20-,21-/m1/s1 |
| InChIKey | GWBCNGGINKMAOK-HRQSHJORSA-N |
| XLogP | 0.88 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |