C21H31N5O2 — CID 172659091
[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone (PubChem CID 172659091) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone |
|---|---|
| PubChem CID | 172659091 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3cnn4ccn(C)c34)C[C@@H]2C[C@H]1OCC1CC1 |
| InChI | InChI=1S/C21H31N5O2/c1-23(2)18-8-15-11-25(12-16(15)9-19(18)28-13-14-4-5-14)21(27)17-10-22-26-7-6-24(3)20(17)26/h6-7,10,14-16,18-19H,4-5,8-9,11-13H2,1-3H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | IFWSCRZUDIYTEX-UKBAYJJMSA-N |
| XLogP | 1.88 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |