C20H29N3O3 — CID 172659470
2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3-methyl-1,5,6,7-tetrahydroindol-4-one (PubChem CID 172659470) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3-methyl-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3-methyl-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 172659470 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3-methyl-1,5,6,7-tetrahydroindol-4-one |
| SMILES | Cc1c(C(=O)N2C[C@H]3C[C@@H](N(C)C)[C@H](O)C[C@H]3C2)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C20H29N3O3/c1-11-18-14(5-4-6-16(18)24)21-19(11)20(26)23-9-12-7-15(22(2)3)17(25)8-13(12)10-23/h12-13,15,17,21,25H,4-10H2,1-3H3/t12-,13+,15-,17-/m1/s1 |
| InChIKey | HILQYFGBXFNJGL-IARIHHJXSA-N |
| XLogP | 1.62 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |